C29H21ClN2O2S — CID 126087091
(5E)-5-[(3-chloro-4-phenylmethoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126087091) has the molecular formula C29H21ClN2O2S and a molecular weight of 497.02 g/mol. Its IUPAC name is (5E)-5-[(3-chloro-4-phenylmethoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(3-chloro-4-phenylmethoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126087091 |
| Molecular Formula | C29H21ClN2O2S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | (5E)-5-[(3-chloro-4-phenylmethoxyphenyl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(OCc3ccccc3)c(Cl)c2)S/C(=N\c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C29H21ClN2O2S/c30-25-18-22(16-17-26(25)34-20-21-10-4-1-5-11-21)19-27-28(33)32(24-14-8-3-9-15-24)29(35-27)31-23-12-6-2-7-13-23/h1-19H,20H2/b27-19+,31-29- |
| InChIKey | NYFJMLBNURXZBI-BXZFMNKHSA-N |
| XLogP | 7.73 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|