C30H20Cl2N2O4S — CID 126084399
4-[[2,6-dichloro-4-[(E)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid (PubChem CID 126084399) has the molecular formula C30H20Cl2N2O4S and a molecular weight of 575.47 g/mol. Its IUPAC name is 4-[[2,6-dichloro-4-[(E)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2,6-dichloro-4-[(E)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126084399 |
| Molecular Formula | C30H20Cl2N2O4S |
| Molecular Weight | 575.47 g/mol |
| Exact Mass | 574.05 |
| IUPAC Name | 4-[[2,6-dichloro-4-[(E)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(COc2c(Cl)cc(/C=C3/S/C(=N\c4ccccc4)N(c4ccccc4)C3=O)cc2Cl)cc1 |
| InChI | InChI=1S/C30H20Cl2N2O4S/c31-24-15-20(16-25(32)27(24)38-18-19-11-13-21(14-12-19)29(36)37)17-26-28(35)34(23-9-5-2-6-10-23)30(39-26)33-22-7-3-1-4-8-22/h1-17H,18H2,(H,36,37)/b26-17+,33-30- |
| InChIKey | GHXDZCLKDJSPFQ-AHXPITADSA-N |
| XLogP | 8.08 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.47 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|