C31H21Cl3N2O4S — CID 4240642
4-[[5-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]methyl]benzoic acid (PubChem CID 4240642) has the molecular formula C31H21Cl3N2O4S and a molecular weight of 623.95 g/mol. Its IUPAC name is 4-[[5-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]methyl]benzoic acid.
| Compound Name | 4-[[5-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 4240642 |
| Molecular Formula | C31H21Cl3N2O4S |
| Molecular Weight | 623.95 g/mol |
| Exact Mass | 622.03 |
| IUPAC Name | 4-[[5-[[3,5-dichloro-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-phenylimino-1,3-thiazolidin-3-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CN2C(=O)C(=Cc3cc(Cl)c(OCc4ccccc4Cl)c(Cl)c3)S/C2=N\c2ccccc2)cc1 |
| InChI | InChI=1S/C31H21Cl3N2O4S/c32-24-9-5-4-6-22(24)18-40-28-25(33)14-20(15-26(28)34)16-27-29(37)36(17-19-10-12-21(13-11-19)30(38)39)31(41-27)35-23-7-2-1-3-8-23/h1-16H,17-18H2,(H,38,39)/b27-16?,35-31- |
| InChIKey | AZUSFDIHHVKTIV-RAWFKEKWSA-N |
| XLogP | 8.73 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.95 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|