C27H20ClN3O3S2 — CID 18844503
(2E,5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-phenyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one (PubChem CID 18844503) has the molecular formula C27H20ClN3O3S2 and a molecular weight of 534.06 g/mol. Its IUPAC name is (2E,5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-phenyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one.
| Compound Name | (2E,5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-phenyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 18844503 |
| Molecular Formula | C27H20ClN3O3S2 |
| Molecular Weight | 534.06 g/mol |
| Exact Mass | 533.06 |
| IUPAC Name | (2E,5Z)-5-[[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-3-phenyl-2-(1,3-thiazol-2-ylimino)-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N/c3nccs3)N(c3ccccc3)C2=O)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H20ClN3O3S2/c1-33-23-15-19(9-12-22(23)34-17-18-7-10-20(28)11-8-18)16-24-25(32)31(21-5-3-2-4-6-21)27(36-24)30-26-29-13-14-35-26/h2-16H,17H2,1H3/b24-16-,30-27+ |
| InChIKey | JQTDWMIGODPSTO-HCWOZANHSA-N |
| XLogP | 7.19 |
| TPSA | 64.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.06 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|