C25H24N2OS2 — CID 4668170
3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 4668170) has the molecular formula C25H24N2OS2 and a molecular weight of 432.61 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 4668170 |
| Molecular Formula | C25H24N2OS2 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-5-[(3-methylthiophen-2-yl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\SC(=Cc3sccc3C)C(=O)N2c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C25H24N2OS2/c1-15-6-8-20(12-18(15)4)26-25-27(21-9-7-16(2)19(5)13-21)24(28)23(30-25)14-22-17(3)10-11-29-22/h6-14H,1-5H3/b23-14?,26-25- |
| InChIKey | FIJWMXCSVRBIGI-ASJAJVQQSA-N |
| XLogP | 7.10 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|