C25H18Cl4N2O2S — CID 126084674
(5E)-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[(3,5-dichloro-2-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 126084674) has the molecular formula C25H18Cl4N2O2S and a molecular weight of 552.31 g/mol. Its IUPAC name is (5E)-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[(3,5-dichloro-2-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[(3,5-dichloro-2-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126084674 |
| Molecular Formula | C25H18Cl4N2O2S |
| Molecular Weight | 552.31 g/mol |
| Exact Mass | 549.98 |
| IUPAC Name | (5E)-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[(3,5-dichloro-2-methoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1c(Cl)cc(Cl)cc1/C=C1/S/C(=N\c2ccc(C)c(Cl)c2)N(c2ccc(C)c(Cl)c2)C1=O |
| InChI | InChI=1S/C25H18Cl4N2O2S/c1-13-4-6-17(11-19(13)27)30-25-31(18-7-5-14(2)20(28)12-18)24(32)22(34-25)9-15-8-16(26)10-21(29)23(15)33-3/h4-12H,1-3H3/b22-9+,30-25- |
| InChIKey | BPHSMCAIWHOKGT-VHRVEHFKSA-N |
| XLogP | 8.73 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.31 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|