C30H20BrCl3N2O4S2 — CID 126085309
[4-bromo-2-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126085309) has the molecular formula C30H20BrCl3N2O4S2 and a molecular weight of 722.90 g/mol. Its IUPAC name is [4-bromo-2-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-bromo-2-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126085309 |
| Molecular Formula | C30H20BrCl3N2O4S2 |
| Molecular Weight | 722.90 g/mol |
| Exact Mass | 719.91 |
| IUPAC Name | [4-bromo-2-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | Cc1ccc(/N=C2\S/C(=C/c3cc(Br)ccc3OS(=O)(=O)c3ccc(Cl)cc3)C(=O)N2c2ccc(C)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C30H20BrCl3N2O4S2/c1-17-3-8-22(15-25(17)33)35-30-36(23-9-4-18(2)26(34)16-23)29(37)28(41-30)14-19-13-20(31)5-12-27(19)40-42(38,39)24-10-6-21(32)7-11-24/h3-16H,1-2H3/b28-14+,35-30- |
| InChIKey | JJJPCBAWXKQMLR-KUEBGGHKSA-N |
| XLogP | 9.60 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.90 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|