C32H24Cl4N2O5S2 — CID 126087491
[2-chloro-4-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenyl] 4-chlorobenzenesulfonate (PubChem CID 126087491) has the molecular formula C32H24Cl4N2O5S2 and a molecular weight of 722.50 g/mol. Its IUPAC name is [2-chloro-4-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-chloro-4-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126087491 |
| Molecular Formula | C32H24Cl4N2O5S2 |
| Molecular Weight | 722.50 g/mol |
| Exact Mass | 719.99 |
| IUPAC Name | [2-chloro-4-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenyl] 4-chlorobenzenesulfonate |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(C)c(Cl)c3)N(c3ccc(C)c(Cl)c3)C2=O)cc(Cl)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H24Cl4N2O5S2/c1-4-42-28-14-20(13-27(36)30(28)43-45(40,41)24-11-7-21(33)8-12-24)15-29-31(39)38(23-10-6-19(3)26(35)17-23)32(44-29)37-22-9-5-18(2)25(34)16-22/h5-17H,4H2,1-3H3/b29-15+,37-32- |
| InChIKey | OULHAKOGXIAKBP-FUHYWVMOSA-N |
| XLogP | 9.89 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.50 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|