C29H26Cl2N2O3S — CID 126086219
(5E)-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 126086219) has the molecular formula C29H26Cl2N2O3S and a molecular weight of 553.51 g/mol. Its IUPAC name is (5E)-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126086219 |
| Molecular Formula | C29H26Cl2N2O3S |
| Molecular Weight | 553.51 g/mol |
| Exact Mass | 552.10 |
| IUPAC Name | (5E)-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[(3-ethoxy-4-prop-2-enoxyphenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | C=CCOc1ccc(/C=C2/S/C(=N\c3ccc(C)c(Cl)c3)N(c3ccc(C)c(Cl)c3)C2=O)cc1OCC |
| InChI | InChI=1S/C29H26Cl2N2O3S/c1-5-13-36-25-12-9-20(14-26(25)35-6-2)15-27-28(34)33(22-11-8-19(4)24(31)17-22)29(37-27)32-21-10-7-18(3)23(30)16-21/h5,7-12,14-17H,1,6,13H2,2-4H3/b27-15+,32-29- |
| InChIKey | GPYOLMZUXYUJMV-AEGCNQERSA-N |
| XLogP | 8.38 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.51 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|