C37H32Cl2N2O5S — CID 126086274
4-[[4-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid (PubChem CID 126086274) has the molecular formula C37H32Cl2N2O5S and a molecular weight of 687.65 g/mol. Its IUPAC name is 4-[[4-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126086274 |
| Molecular Formula | C37H32Cl2N2O5S |
| Molecular Weight | 687.65 g/mol |
| Exact Mass | 686.14 |
| IUPAC Name | 4-[[4-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-prop-2-enylphenoxy]methyl]benzoic acid |
| SMILES | C=CCc1cc(/C=C2/S/C(=N\c3ccc(C)c(Cl)c3)N(c3ccc(C)c(Cl)c3)C2=O)cc(OCC)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C37H32Cl2N2O5S/c1-5-7-27-16-25(17-32(45-6-2)34(27)46-21-24-10-12-26(13-11-24)36(43)44)18-33-35(42)41(29-15-9-23(4)31(39)20-29)37(47-33)40-28-14-8-22(3)30(38)19-28/h5,8-20H,1,6-7,21H2,2-4H3,(H,43,44)/b33-18+,40-37- |
| InChIKey | GXMPQCMFXIOFFH-MTRPASKASA-N |
| XLogP | 9.82 |
| TPSA | 88.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.65 |
| LogP ≤ 5 | 9.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|