C35H29Cl2FN2O3S — CID 126094887
(5E)-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[[4-[(2-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 126094887) has the molecular formula C35H29Cl2FN2O3S and a molecular weight of 647.60 g/mol. Its IUPAC name is (5E)-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[[4-[(2-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[[4-[(2-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126094887 |
| Molecular Formula | C35H29Cl2FN2O3S |
| Molecular Weight | 647.60 g/mol |
| Exact Mass | 646.13 |
| IUPAC Name | (5E)-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[[4-[(2-fluorophenyl)methoxy]-3-methoxy-5-prop-2-enylphenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | C=CCc1cc(/C=C2/S/C(=N\c3ccc(C)c(Cl)c3)N(c3ccc(C)c(Cl)c3)C2=O)cc(OC)c1OCc1ccccc1F |
| InChI | InChI=1S/C35H29Cl2FN2O3S/c1-5-8-24-15-23(16-31(42-4)33(24)43-20-25-9-6-7-10-30(25)38)17-32-34(41)40(27-14-12-22(3)29(37)19-27)35(44-32)39-26-13-11-21(2)28(36)18-26/h5-7,9-19H,1,8,20H2,2-4H3/b32-17+,39-35- |
| InChIKey | KGMSWVYYCRXDCB-IVADMTCHSA-N |
| XLogP | 9.87 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.60 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|