C33H26BrCl3N2O3S — CID 126088884
(5E)-5-[[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylidene]-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-1,3-thiazolidin-4-one (PubChem CID 126088884) has the molecular formula C33H26BrCl3N2O3S and a molecular weight of 716.91 g/mol. Its IUPAC name is (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylidene]-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylidene]-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126088884 |
| Molecular Formula | C33H26BrCl3N2O3S |
| Molecular Weight | 716.91 g/mol |
| Exact Mass | 713.99 |
| IUPAC Name | (5E)-5-[[4-[(4-bromophenyl)methoxy]-3-chloro-5-ethoxyphenyl]methylidene]-3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(C)c(Cl)c3)N(c3ccc(C)c(Cl)c3)C2=O)cc(Cl)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C33H26BrCl3N2O3S/c1-4-41-29-14-22(13-28(37)31(29)42-18-21-7-9-23(34)10-8-21)15-30-32(40)39(25-12-6-20(3)27(36)17-25)33(43-30)38-24-11-5-19(2)26(35)16-24/h5-17H,4,18H2,1-3H3/b30-15+,38-33- |
| InChIKey | SSEWJWHSLWTGCS-HXFWGFHUSA-N |
| XLogP | 10.81 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.91 |
| LogP ≤ 5 | 10.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|