C24H17Cl2FN2OS — CID 3611924
3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[(3-fluorophenyl)methylidene]-1,3-thiazolidin-4-one (PubChem CID 3611924) has the molecular formula C24H17Cl2FN2OS and a molecular weight of 471.38 g/mol. Its IUPAC name is 3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[(3-fluorophenyl)methylidene]-1,3-thiazolidin-4-one.
| Compound Name | 3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[(3-fluorophenyl)methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3611924 |
| Molecular Formula | C24H17Cl2FN2OS |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-5-[(3-fluorophenyl)methylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(/N=C2\SC(=Cc3cccc(F)c3)C(=O)N2c2ccc(C)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C24H17Cl2FN2OS/c1-14-6-8-18(12-20(14)25)28-24-29(19-9-7-15(2)21(26)13-19)23(30)22(31-24)11-16-4-3-5-17(27)10-16/h3-13H,1-2H3/b22-11?,28-24- |
| InChIKey | UEZQPYYTQLAVNE-AAXGQYHWSA-N |
| XLogP | 7.56 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|