C30H20Cl4N2O4S2 — CID 126088673
[2,4-dichloro-6-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzenesulfonate (PubChem CID 126088673) has the molecular formula C30H20Cl4N2O4S2 and a molecular weight of 678.45 g/mol. Its IUPAC name is [2,4-dichloro-6-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [2,4-dichloro-6-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126088673 |
| Molecular Formula | C30H20Cl4N2O4S2 |
| Molecular Weight | 678.45 g/mol |
| Exact Mass | 675.96 |
| IUPAC Name | [2,4-dichloro-6-[(E)-[3-(3-chloro-4-methylphenyl)-2-(3-chloro-4-methylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenyl] benzenesulfonate |
| SMILES | Cc1ccc(/N=C2\S/C(=C/c3cc(Cl)cc(Cl)c3OS(=O)(=O)c3ccccc3)C(=O)N2c2ccc(C)c(Cl)c2)cc1Cl |
| InChI | InChI=1S/C30H20Cl4N2O4S2/c1-17-8-10-21(15-24(17)32)35-30-36(22-11-9-18(2)25(33)16-22)29(37)27(41-30)13-19-12-20(31)14-26(34)28(19)40-42(38,39)23-6-4-3-5-7-23/h3-16H,1-2H3/b27-13+,35-30- |
| InChIKey | IWSUTAYKRCKRHK-GLCWZYTOSA-N |
| XLogP | 9.49 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.45 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|