C28H26N2O4S — CID 3386126
2-[4-[[3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 3386126) has the molecular formula C28H26N2O4S and a molecular weight of 486.59 g/mol. Its IUPAC name is 2-[4-[[3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[[3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 3386126 |
| Molecular Formula | C28H26N2O4S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 2-[4-[[3-(3,4-dimethylphenyl)-2-(3,4-dimethylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | Cc1ccc(/N=C2\SC(=Cc3ccc(OCC(=O)O)cc3)C(=O)N2c2ccc(C)c(C)c2)cc1C |
| InChI | InChI=1S/C28H26N2O4S/c1-17-5-9-22(13-19(17)3)29-28-30(23-10-6-18(2)20(4)14-23)27(33)25(35-28)15-21-7-11-24(12-8-21)34-16-26(31)32/h5-15H,16H2,1-4H3,(H,31,32)/b25-15?,29-28- |
| InChIKey | CLQMCQMQHGZFRY-CLKKVCERSA-N |
| XLogP | 6.19 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|