C29H17F5N2O3S — CID 126342809
(5Z)-5-[[3-methoxy-4-(2,3,4,5,6-pentafluorophenoxy)phenyl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 126342809) has the molecular formula C29H17F5N2O3S and a molecular weight of 568.52 g/mol. Its IUPAC name is (5Z)-5-[[3-methoxy-4-(2,3,4,5,6-pentafluorophenoxy)phenyl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-methoxy-4-(2,3,4,5,6-pentafluorophenoxy)phenyl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126342809 |
| Molecular Formula | C29H17F5N2O3S |
| Molecular Weight | 568.52 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | (5Z)-5-[[3-methoxy-4-(2,3,4,5,6-pentafluorophenoxy)phenyl]methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | COc1cc(/C=C2\S/C(=N\c3ccccc3)N(c3ccccc3)C2=O)ccc1Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C29H17F5N2O3S/c1-38-20-14-16(12-13-19(20)39-27-25(33)23(31)22(30)24(32)26(27)34)15-21-28(37)36(18-10-6-3-7-11-18)29(40-21)35-17-8-4-2-5-9-17/h2-15H,1H3/b21-15-,35-29- |
| InChIKey | UYFPMZTVOIOSCN-DEKDQGNPSA-N |
| XLogP | 7.99 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.52 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|