C22H19Cl2NO4S — CID 126223119
[2-chloro-6-ethoxy-4-[(2-methylphenyl)iminomethyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 126223119) has the molecular formula C22H19Cl2NO4S and a molecular weight of 464.37 g/mol. Its IUPAC name is [2-chloro-6-ethoxy-4-[(2-methylphenyl)iminomethyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-chloro-6-ethoxy-4-[(2-methylphenyl)iminomethyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126223119 |
| Molecular Formula | C22H19Cl2NO4S |
| Molecular Weight | 464.37 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | [2-chloro-6-ethoxy-4-[(2-methylphenyl)iminomethyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | CCOc1cc(/C=N/c2ccccc2C)cc(Cl)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H19Cl2NO4S/c1-3-28-21-13-16(14-25-20-7-5-4-6-15(20)2)12-19(24)22(21)29-30(26,27)18-10-8-17(23)9-11-18/h4-14H,3H2,1-2H3/b25-14+ |
| InChIKey | MJYXGVHMVXDSFO-AFUMVMLFSA-N |
| XLogP | 6.22 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.37 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|