C18H14Cl2N2O5S2 — CID 2174580
[4-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-chloro-6-ethoxyphenyl] 4-chlorobenzenesulfonate (PubChem CID 2174580) has the molecular formula C18H14Cl2N2O5S2 and a molecular weight of 473.36 g/mol. Its IUPAC name is [4-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-chloro-6-ethoxyphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-chloro-6-ethoxyphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 2174580 |
| Molecular Formula | C18H14Cl2N2O5S2 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 471.97 |
| IUPAC Name | [4-[(Z)-(2-amino-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-chloro-6-ethoxyphenyl] 4-chlorobenzenesulfonate |
| SMILES | CCOc1cc(/C=C2\SC(N)=NC2=O)cc(Cl)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H14Cl2N2O5S2/c1-2-26-14-8-10(9-15-17(23)22-18(21)28-15)7-13(20)16(14)27-29(24,25)12-5-3-11(19)4-6-12/h3-9H,2H2,1H3,(H2,21,22,23)/b15-9- |
| InChIKey | UMPGCKMGYAGSLD-DHDCSXOGSA-N |
| XLogP | 4.09 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|