C20H17ClN2O6S2 — CID 126091610
[4-[(E)-(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-ethoxyphenyl] 4-chlorobenzenesulfonate (PubChem CID 126091610) has the molecular formula C20H17ClN2O6S2 and a molecular weight of 480.95 g/mol. Its IUPAC name is [4-[(E)-(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-ethoxyphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-[(E)-(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-ethoxyphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126091610 |
| Molecular Formula | C20H17ClN2O6S2 |
| Molecular Weight | 480.95 g/mol |
| Exact Mass | 480.02 |
| IUPAC Name | [4-[(E)-(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-ethoxyphenyl] 4-chlorobenzenesulfonate |
| SMILES | CCOc1cc(/C=C2/SC(NC(C)=O)=NC2=O)ccc1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClN2O6S2/c1-3-28-17-10-13(11-18-19(25)23-20(30-18)22-12(2)24)4-9-16(17)29-31(26,27)15-7-5-14(21)6-8-15/h4-11H,3H2,1-2H3,(H,22,23,24,25)/b18-11+ |
| InChIKey | YZVHUYYMMHZXCG-WOJGMQOQSA-N |
| XLogP | 3.61 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.95 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|