C21H18ClNO5S3 — CID 2175432
[2-ethoxy-4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 2175432) has the molecular formula C21H18ClNO5S3 and a molecular weight of 496.03 g/mol. Its IUPAC name is [2-ethoxy-4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-ethoxy-4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 2175432 |
| Molecular Formula | C21H18ClNO5S3 |
| Molecular Weight | 496.03 g/mol |
| Exact Mass | 495.00 |
| IUPAC Name | [2-ethoxy-4-[(E)-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | C=CCN1C(=O)/C(=C\c2ccc(OS(=O)(=O)c3ccc(Cl)cc3)c(OCC)c2)SC1=S |
| InChI | InChI=1S/C21H18ClNO5S3/c1-3-11-23-20(24)19(30-21(23)29)13-14-5-10-17(18(12-14)27-4-2)28-31(25,26)16-8-6-15(22)7-9-16/h3,5-10,12-13H,1,4,11H2,2H3/b19-13+ |
| InChIKey | WBFGAPCKENIJLC-CPNJWEJPSA-N |
| XLogP | 4.89 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.03 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|