C18H12BrClN2O5S2 — CID 126088118
[4-[(E)-(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-bromophenyl] 4-chlorobenzenesulfonate (PubChem CID 126088118) has the molecular formula C18H12BrClN2O5S2 and a molecular weight of 515.79 g/mol. Its IUPAC name is [4-[(E)-(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-bromophenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-[(E)-(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-bromophenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126088118 |
| Molecular Formula | C18H12BrClN2O5S2 |
| Molecular Weight | 515.79 g/mol |
| Exact Mass | 513.91 |
| IUPAC Name | [4-[(E)-(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-bromophenyl] 4-chlorobenzenesulfonate |
| SMILES | CC(=O)NC1=NC(=O)/C(=C\c2ccc(OS(=O)(=O)c3ccc(Cl)cc3)c(Br)c2)S1 |
| InChI | InChI=1S/C18H12BrClN2O5S2/c1-10(23)21-18-22-17(24)16(28-18)9-11-2-7-15(14(19)8-11)27-29(25,26)13-5-3-12(20)4-6-13/h2-9H,1H3,(H,21,22,23,24)/b16-9+ |
| InChIKey | HXJMAFYDFBPJRW-CXUHLZMHSA-N |
| XLogP | 3.98 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.79 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|