C20H15Cl2N3O4S — CID 5210562
2-[4-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-chlorophenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 5210562) has the molecular formula C20H15Cl2N3O4S and a molecular weight of 464.33 g/mol. Its IUPAC name is 2-[4-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-chlorophenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[4-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-chlorophenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 5210562 |
| Molecular Formula | C20H15Cl2N3O4S |
| Molecular Weight | 464.33 g/mol |
| Exact Mass | 463.02 |
| IUPAC Name | 2-[4-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-2-chlorophenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | CC(=O)NC1=NC(=O)C(=Cc2ccc(OCC(=O)Nc3ccc(Cl)cc3)c(Cl)c2)S1 |
| InChI | InChI=1S/C20H15Cl2N3O4S/c1-11(26)23-20-25-19(28)17(30-20)9-12-2-7-16(15(22)8-12)29-10-18(27)24-14-5-3-13(21)4-6-14/h2-9H,10H2,1H3,(H,24,27)(H,23,25,26,28) |
| InChIKey | GXLWSHVCHATQCG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.33 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|