C13H10Br2N2O3S — CID 6380740
N-[(5E)-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide (PubChem CID 6380740) has the molecular formula C13H10Br2N2O3S and a molecular weight of 434.11 g/mol. Its IUPAC name is N-[(5E)-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[(5E)-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 6380740 |
| Molecular Formula | C13H10Br2N2O3S |
| Molecular Weight | 434.11 g/mol |
| Exact Mass | 431.88 |
| IUPAC Name | N-[(5E)-5-[(3,5-dibromo-4-methoxyphenyl)methylidene]-4-oxo-1,3-thiazol-2-yl]acetamide |
| SMILES | COc1c(Br)cc(/C=C2/SC(NC(C)=O)=NC2=O)cc1Br |
| InChI | InChI=1S/C13H10Br2N2O3S/c1-6(18)16-13-17-12(19)10(21-13)5-7-3-8(14)11(20-2)9(15)4-7/h3-5H,1-2H3,(H,16,17,18,19)/b10-5+ |
| InChIKey | FQDZCLKZQZLGPM-BJMVGYQFSA-N |
| XLogP | 3.33 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.11 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|