C15H13BrN2O5S — CID 1217417
[4-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-5-bromo-2-methoxyphenyl] acetate (PubChem CID 1217417) has the molecular formula C15H13BrN2O5S and a molecular weight of 413.25 g/mol. Its IUPAC name is [4-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-5-bromo-2-methoxyphenyl] acetate.
| Compound Name | [4-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-5-bromo-2-methoxyphenyl] acetate |
|---|---|
| PubChem CID | 1217417 |
| Molecular Formula | C15H13BrN2O5S |
| Molecular Weight | 413.25 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | [4-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-5-bromo-2-methoxyphenyl] acetate |
| SMILES | COc1cc(C=C2SC(NC(C)=O)=NC2=O)c(Br)cc1OC(C)=O |
| InChI | InChI=1S/C15H13BrN2O5S/c1-7(19)17-15-18-14(21)13(24-15)5-9-4-11(22-3)12(6-10(9)16)23-8(2)20/h4-6H,1-3H3,(H,17,18,19,21) |
| InChIKey | WLKKGERSLCHIJC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.25 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|