C14H10BrN3O6S — CID 4680793
[2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-6-bromo-4-nitrophenyl] acetate (PubChem CID 4680793) has the molecular formula C14H10BrN3O6S and a molecular weight of 428.22 g/mol. Its IUPAC name is [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-6-bromo-4-nitrophenyl] acetate.
| Compound Name | [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-6-bromo-4-nitrophenyl] acetate |
|---|---|
| PubChem CID | 4680793 |
| Molecular Formula | C14H10BrN3O6S |
| Molecular Weight | 428.22 g/mol |
| Exact Mass | 426.95 |
| IUPAC Name | [2-[(2-acetamido-4-oxo-1,3-thiazol-5-ylidene)methyl]-6-bromo-4-nitrophenyl] acetate |
| SMILES | CC(=O)NC1=NC(=O)C(=Cc2cc([N+](=O)[O-])cc(Br)c2OC(C)=O)S1 |
| InChI | InChI=1S/C14H10BrN3O6S/c1-6(19)16-14-17-13(21)11(25-14)4-8-3-9(18(22)23)5-10(15)12(8)24-7(2)20/h3-5H,1-2H3,(H,16,17,19,21) |
| InChIKey | DCHLLNTWBSKROG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.22 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|