C10H6BrN3O4S — CID 2243818
(5Z)-2-amino-5-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-1,3-thiazol-4-one (PubChem CID 2243818) has the molecular formula C10H6BrN3O4S and a molecular weight of 344.15 g/mol. Its IUPAC name is (5Z)-2-amino-5-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-1,3-thiazol-4-one.
| Compound Name | (5Z)-2-amino-5-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 2243818 |
| Molecular Formula | C10H6BrN3O4S |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 342.93 |
| IUPAC Name | (5Z)-2-amino-5-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-1,3-thiazol-4-one |
| SMILES | NC1=NC(=O)/C(=C/c2cc([N+](=O)[O-])cc(Br)c2O)S1 |
| InChI | InChI=1S/C10H6BrN3O4S/c11-6-3-5(14(17)18)1-4(8(6)15)2-7-9(16)13-10(12)19-7/h1-3,15H,(H2,12,13,16)/b7-2- |
| InChIKey | VQHDGDIZGFPOHZ-UQCOIBPSSA-N |
| XLogP | 1.99 |
| TPSA | 118.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|