C10H6BrN3O4S — CID 3752635
5-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 3752635) has the molecular formula C10H6BrN3O4S and a molecular weight of 344.15 g/mol. Its IUPAC name is 5-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 3752635 |
| Molecular Formula | C10H6BrN3O4S |
| Molecular Weight | 344.15 g/mol |
| Exact Mass | 342.93 |
| IUPAC Name | 5-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1NC(=S)NC1=Cc1cc([N+](=O)[O-])cc(Br)c1O |
| InChI | InChI=1S/C10H6BrN3O4S/c11-6-3-5(14(17)18)1-4(8(6)15)2-7-9(16)13-10(19)12-7/h1-3,15H,(H2,12,13,16,19) |
| InChIKey | PAQBQVOELAAZJF-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.15 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|