C12H10BrN3O5 — CID 126243745
(5E)-5-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-3-ethylimidazolidine-2,4-dione (PubChem CID 126243745) has the molecular formula C12H10BrN3O5 and a molecular weight of 356.13 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-3-ethylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-3-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126243745 |
| Molecular Formula | C12H10BrN3O5 |
| Molecular Weight | 356.13 g/mol |
| Exact Mass | 354.98 |
| IUPAC Name | (5E)-5-[(3-bromo-2-hydroxy-5-nitrophenyl)methylidene]-3-ethylimidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N/C(=C/c2cc([N+](=O)[O-])cc(Br)c2O)C1=O |
| InChI | InChI=1S/C12H10BrN3O5/c1-2-15-11(18)9(14-12(15)19)4-6-3-7(16(20)21)5-8(13)10(6)17/h3-5,17H,2H2,1H3,(H,14,19)/b9-4+ |
| InChIKey | VISAJPWLBLDRAC-RUDMXATFSA-N |
| XLogP | 1.98 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.13 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|