C13H11BrN2O4 — CID 126227722
(5Z)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-3-ethylimidazolidine-2,4-dione (PubChem CID 126227722) has the molecular formula C13H11BrN2O4 and a molecular weight of 339.15 g/mol. Its IUPAC name is (5Z)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-3-ethylimidazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-3-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126227722 |
| Molecular Formula | C13H11BrN2O4 |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | (5Z)-5-[(6-bromo-1,3-benzodioxol-5-yl)methylidene]-3-ethylimidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N/C(=C\c2cc3c(cc2Br)OCO3)C1=O |
| InChI | InChI=1S/C13H11BrN2O4/c1-2-16-12(17)9(15-13(16)18)3-7-4-10-11(5-8(7)14)20-6-19-10/h3-5H,2,6H2,1H3,(H,15,18)/b9-3- |
| InChIKey | RNTFPCKIMHKGMR-OQFOIZHKSA-N |
| XLogP | 2.09 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|