C14H11ClN2O4 — CID 955524
5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione (PubChem CID 955524) has the molecular formula C14H11ClN2O4 and a molecular weight of 306.71 g/mol. Its IUPAC name is 5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione.
| Compound Name | 5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 955524 |
| Molecular Formula | C14H11ClN2O4 |
| Molecular Weight | 306.71 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 5-[(6-chloro-1,3-benzodioxol-5-yl)methylidene]-3-prop-2-enylimidazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)NC(=Cc2cc3c(cc2Cl)OCO3)C1=O |
| InChI | InChI=1S/C14H11ClN2O4/c1-2-3-17-13(18)10(16-14(17)19)4-8-5-11-12(6-9(8)15)21-7-20-11/h2,4-6H,1,3,7H2,(H,16,19) |
| InChIKey | BFLUNLMSIRFEEI-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.71 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|