C13H12BrClN2O3 — CID 126246821
(5E)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-propylimidazolidine-2,4-dione (PubChem CID 126246821) has the molecular formula C13H12BrClN2O3 and a molecular weight of 359.61 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-propylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126246821 |
| Molecular Formula | C13H12BrClN2O3 |
| Molecular Weight | 359.61 g/mol |
| Exact Mass | 357.97 |
| IUPAC Name | (5E)-5-[(3-bromo-5-chloro-2-hydroxyphenyl)methylidene]-3-propylimidazolidine-2,4-dione |
| SMILES | CCCN1C(=O)N/C(=C/c2cc(Cl)cc(Br)c2O)C1=O |
| InChI | InChI=1S/C13H12BrClN2O3/c1-2-3-17-12(19)10(16-13(17)20)5-7-4-8(15)6-9(14)11(7)18/h4-6,18H,2-3H2,1H3,(H,16,20)/b10-5+ |
| InChIKey | USCWKTLASAYCGI-BJMVGYQFSA-N |
| XLogP | 3.11 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.61 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|