C15H7Br2N3O5S — CID 1105595
5-[[5-(2,6-dibromo-4-nitrophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 1105595) has the molecular formula C15H7Br2N3O5S and a molecular weight of 501.11 g/mol. Its IUPAC name is 5-[[5-(2,6-dibromo-4-nitrophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[5-(2,6-dibromo-4-nitrophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 1105595 |
| Molecular Formula | C15H7Br2N3O5S |
| Molecular Weight | 501.11 g/mol |
| Exact Mass | 498.85 |
| IUPAC Name | 5-[[5-(2,6-dibromo-4-nitrophenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | O=C1NC(=S)NC(=O)C1=Cc1ccc(-c2c(Br)cc([N+](=O)[O-])cc2Br)o1 |
| InChI | InChI=1S/C15H7Br2N3O5S/c16-9-3-6(20(23)24)4-10(17)12(9)11-2-1-7(25-11)5-8-13(21)18-15(26)19-14(8)22/h1-5H,(H2,18,19,21,22,26) |
| InChIKey | DAIYGQLBCFNHPU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.11 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|