C14H9N3O5S — CID 4597804
5-[[5-(4-hydroxy-3-nitrophenyl)furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one (PubChem CID 4597804) has the molecular formula C14H9N3O5S and a molecular weight of 331.31 g/mol. Its IUPAC name is 5-[[5-(4-hydroxy-3-nitrophenyl)furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-[[5-(4-hydroxy-3-nitrophenyl)furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 4597804 |
| Molecular Formula | C14H9N3O5S |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 5-[[5-(4-hydroxy-3-nitrophenyl)furan-2-yl]methylidene]-2-sulfanylideneimidazolidin-4-one |
| SMILES | O=C1NC(=S)NC1=Cc1ccc(-c2ccc(O)c([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C14H9N3O5S/c18-11-3-1-7(5-10(11)17(20)21)12-4-2-8(22-12)6-9-13(19)16-14(23)15-9/h1-6,18H,(H2,15,16,19,23) |
| InChIKey | VFYRDZZHJAJAGL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|