C18H11N3O6 — CID 21230302
(5Z)-5-[[5-(4-hydroxy-3-nitrophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 21230302) has the molecular formula C18H11N3O6 and a molecular weight of 365.30 g/mol. Its IUPAC name is (5Z)-5-[[5-(4-hydroxy-3-nitrophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-5-[[5-(4-hydroxy-3-nitrophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 21230302 |
| Molecular Formula | C18H11N3O6 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | (5Z)-5-[[5-(4-hydroxy-3-nitrophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | CC1=C(C#N)C(=O)NC(=O)/C1=C\c1ccc(-c2ccc(O)c([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C18H11N3O6/c1-9-12(17(23)20-18(24)13(9)8-19)7-11-3-5-16(27-11)10-2-4-15(22)14(6-10)21(25)26/h2-7,22H,1H3,(H,20,23,24)/b12-7- |
| InChIKey | VXLZUTDSNFMQSE-GHXNOFRVSA-N |
| XLogP | 2.44 |
| TPSA | 146.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|