C19H13N3O6 — CID 5292569
(5Z)-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile (PubChem CID 5292569) has the molecular formula C19H13N3O6 and a molecular weight of 379.33 g/mol. Its IUPAC name is (5Z)-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile.
| Compound Name | (5Z)-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5292569 |
| Molecular Formula | C19H13N3O6 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.08 |
| IUPAC Name | (5Z)-5-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-4-methyl-2,6-dioxopyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2ccc(/C=C3\C(=O)NC(=O)C(C#N)=C3C)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H13N3O6/c1-10-14(18(23)21-19(24)15(10)9-20)7-12-4-6-17(28-12)13-5-3-11(27-2)8-16(13)22(25)26/h3-8H,1-2H3,(H,21,23,24)/b14-7- |
| InChIKey | BKQPJWFIKJMVSX-AUWJEWJLSA-N |
| XLogP | 2.74 |
| TPSA | 135.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|