C20H17NO8 — CID 19656171
8-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione (PubChem CID 19656171) has the molecular formula C20H17NO8 and a molecular weight of 399.36 g/mol. Its IUPAC name is 8-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 19656171 |
| Molecular Formula | C20H17NO8 |
| Molecular Weight | 399.36 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | 8-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-6,10-dioxaspiro[4.5]decane-7,9-dione |
| SMILES | COc1ccc(-c2ccc(C=C3C(=O)OC4(CCCC4)OC3=O)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H17NO8/c1-26-12-4-6-14(16(11-12)21(24)25)17-7-5-13(27-17)10-15-18(22)28-20(29-19(15)23)8-2-3-9-20/h4-7,10-11H,2-3,8-9H2,1H3 |
| InChIKey | LYDMMVHQUUIAFD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 118.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.36 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|