C27H19N3O5 — CID 20833705
(4E)-4-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-2,5-diphenylpyrazol-3-one (PubChem CID 20833705) has the molecular formula C27H19N3O5 and a molecular weight of 465.47 g/mol. Its IUPAC name is (4E)-4-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-2,5-diphenylpyrazol-3-one.
| Compound Name | (4E)-4-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 20833705 |
| Molecular Formula | C27H19N3O5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | (4E)-4-[[5-(4-methoxy-2-nitrophenyl)furan-2-yl]methylidene]-2,5-diphenylpyrazol-3-one |
| SMILES | COc1ccc(-c2ccc(/C=C3/C(=O)N(c4ccccc4)N=C3c3ccccc3)o2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H19N3O5/c1-34-20-12-14-22(24(17-20)30(32)33)25-15-13-21(35-25)16-23-26(18-8-4-2-5-9-18)28-29(27(23)31)19-10-6-3-7-11-19/h2-17H,1H3/b23-16+ |
| InChIKey | HDIOIPNMHMYURW-XQNSMLJCSA-N |
| XLogP | 5.70 |
| TPSA | 98.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|