C26H19N3O4S — CID 17354337
4-[5-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]furan-2-yl]benzenesulfonamide (PubChem CID 17354337) has the molecular formula C26H19N3O4S and a molecular weight of 469.52 g/mol. Its IUPAC name is 4-[5-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]furan-2-yl]benzenesulfonamide.
| Compound Name | 4-[5-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]furan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 17354337 |
| Molecular Formula | C26H19N3O4S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 4-[5-[(Z)-(5-oxo-1,3-diphenylpyrazol-4-ylidene)methyl]furan-2-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2ccc(/C=C3\C(=O)N(c4ccccc4)N=C3c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C26H19N3O4S/c27-34(31,32)22-14-11-18(12-15-22)24-16-13-21(33-24)17-23-25(19-7-3-1-4-8-19)28-29(26(23)30)20-9-5-2-6-10-20/h1-17H,(H2,27,31,32)/b23-17- |
| InChIKey | LEQLTKFANGRBLY-QJOMJCCJSA-N |
| XLogP | 4.43 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|