C26H19N3O4S2 — CID 3444492
4-[5-[(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzenesulfonamide (PubChem CID 3444492) has the molecular formula C26H19N3O4S2 and a molecular weight of 501.59 g/mol. Its IUPAC name is 4-[5-[(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzenesulfonamide.
| Compound Name | 4-[5-[(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3444492 |
| Molecular Formula | C26H19N3O4S2 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.08 |
| IUPAC Name | 4-[5-[(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]furan-2-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2ccc(C=C3S/C(=N\c4ccccc4)N(c4ccccc4)C3=O)o2)cc1 |
| InChI | InChI=1S/C26H19N3O4S2/c27-35(31,32)22-14-11-18(12-15-22)23-16-13-21(33-23)17-24-25(30)29(20-9-5-2-6-10-20)26(34-24)28-19-7-3-1-4-8-19/h1-17H,(H2,27,31,32)/b24-17?,28-26- |
| InChIKey | MFSFWAXWUYWIHO-AQXNVXIFSA-N |
| XLogP | 5.40 |
| TPSA | 105.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|