C21H16N2O4S3 — CID 21178646
4-[5-[(E)-[3-(3-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzenesulfonamide (PubChem CID 21178646) has the molecular formula C21H16N2O4S3 and a molecular weight of 456.57 g/mol. Its IUPAC name is 4-[5-[(E)-[3-(3-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzenesulfonamide.
| Compound Name | 4-[5-[(E)-[3-(3-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 21178646 |
| Molecular Formula | C21H16N2O4S3 |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 4-[5-[(E)-[3-(3-methylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzenesulfonamide |
| SMILES | Cc1cccc(N2C(=O)/C(=C\c3ccc(-c4ccc(S(N)(=O)=O)cc4)o3)SC2=S)c1 |
| InChI | InChI=1S/C21H16N2O4S3/c1-13-3-2-4-15(11-13)23-20(24)19(29-21(23)28)12-16-7-10-18(27-16)14-5-8-17(9-6-14)30(22,25)26/h2-12H,1H3,(H2,22,25,26)/b19-12+ |
| InChIKey | GYNWBJAOCRMYHC-XDHOZWIPSA-N |
| XLogP | 4.31 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|