C25H20N4O5S3 — CID 3114636
4-[5-[[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzenesulfonamide (PubChem CID 3114636) has the molecular formula C25H20N4O5S3 and a molecular weight of 552.66 g/mol. Its IUPAC name is 4-[5-[[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzenesulfonamide.
| Compound Name | 4-[5-[[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 3114636 |
| Molecular Formula | C25H20N4O5S3 |
| Molecular Weight | 552.66 g/mol |
| Exact Mass | 552.06 |
| IUPAC Name | 4-[5-[[3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]benzenesulfonamide |
| SMILES | Cc1c(N2C(=O)C(=Cc3ccc(-c4ccc(S(N)(=O)=O)cc4)o3)SC2=S)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C25H20N4O5S3/c1-15-22(24(31)29(27(15)2)17-6-4-3-5-7-17)28-23(30)21(36-25(28)35)14-18-10-13-20(34-18)16-8-11-19(12-9-16)37(26,32)33/h3-14H,1-2H3,(H2,26,32,33) |
| InChIKey | DHMTYCYPRHGWQO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 120.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.66 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|