C21H17N3O4S2 — CID 6533008
(5Z)-5-[(3,4-dihydroxyphenyl)methylidene]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6533008) has the molecular formula C21H17N3O4S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is (5Z)-5-[(3,4-dihydroxyphenyl)methylidene]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[(3,4-dihydroxyphenyl)methylidene]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6533008 |
| Molecular Formula | C21H17N3O4S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | (5Z)-5-[(3,4-dihydroxyphenyl)methylidene]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1c(N2C(=O)/C(=C/c3ccc(O)c(O)c3)SC2=S)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H17N3O4S2/c1-12-18(20(28)24(22(12)2)14-6-4-3-5-7-14)23-19(27)17(30-21(23)29)11-13-8-9-15(25)16(26)10-13/h3-11,25-26H,1-2H3/b17-11- |
| InChIKey | NJMBBMHRLJAZDF-BOPFTXTBSA-N |
| XLogP | 3.30 |
| TPSA | 87.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|