C22H18BrN3O4S2 — CID 71833643
5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 71833643) has the molecular formula C22H18BrN3O4S2 and a molecular weight of 532.44 g/mol. Its IUPAC name is 5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 71833643 |
| Molecular Formula | C22H18BrN3O4S2 |
| Molecular Weight | 532.44 g/mol |
| Exact Mass | 530.99 |
| IUPAC Name | 5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(C=C2SC(=S)N(c3c(C)n(C)n(-c4ccccc4)c3=O)C2=O)c(Br)cc1O |
| InChI | InChI=1S/C22H18BrN3O4S2/c1-12-19(21(29)26(24(12)2)14-7-5-4-6-8-14)25-20(28)18(32-22(25)31)10-13-9-17(30-3)16(27)11-15(13)23/h4-11,27H,1-3H3 |
| InChIKey | KMHVPGRALVKQAV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|