C25H19N4O4S2- — CID 142897293
(5E)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-5-[[5-[4-(oxidoamino)phenyl]furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 142897293) has the molecular formula C25H19N4O4S2- and a molecular weight of 503.59 g/mol. Its IUPAC name is (5E)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-5-[[5-[4-(oxidoamino)phenyl]furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-5-[[5-[4-(oxidoamino)phenyl]furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 142897293 |
| Molecular Formula | C25H19N4O4S2- |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.09 |
| IUPAC Name | (5E)-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-5-[[5-[4-(oxidoamino)phenyl]furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1c(N2C(=O)/C(=C\c3ccc(-c4ccc(N[O-])cc4)o3)SC2=S)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C25H19N4O4S2/c1-15-22(24(31)29(27(15)2)18-6-4-3-5-7-18)28-23(30)21(35-25(28)34)14-19-12-13-20(33-19)16-8-10-17(26-32)11-9-16/h3-14,26H,1-2H3/q-1/b21-14+ |
| InChIKey | ZELGHPPRRNLVKK-KGENOOAVSA-N |
| XLogP | 5.06 |
| TPSA | 95.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|