C26H20ClN3O3S2 — CID 123188443
5-[[5-(5-chloro-2-methylphenyl)furan-2-yl]methylidene]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 123188443) has the molecular formula C26H20ClN3O3S2 and a molecular weight of 522.05 g/mol. Its IUPAC name is 5-[[5-(5-chloro-2-methylphenyl)furan-2-yl]methylidene]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-[[5-(5-chloro-2-methylphenyl)furan-2-yl]methylidene]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 123188443 |
| Molecular Formula | C26H20ClN3O3S2 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 5-[[5-(5-chloro-2-methylphenyl)furan-2-yl]methylidene]-3-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(Cl)cc1-c1ccc(C=C2SC(=S)N(c3c(C)n(C)n(-c4ccccc4)c3=O)C2=O)o1 |
| InChI | InChI=1S/C26H20ClN3O3S2/c1-15-9-10-17(27)13-20(15)21-12-11-19(33-21)14-22-24(31)29(26(34)35-22)23-16(2)28(3)30(25(23)32)18-7-5-4-6-8-18/h4-14H,1-3H3 |
| InChIKey | ZILWFVVHPUPUOP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 60.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|