C20H13N3O4S — CID 1211318
5-[(5-nitrofuran-2-yl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one (PubChem CID 1211318) has the molecular formula C20H13N3O4S and a molecular weight of 391.41 g/mol. Its IUPAC name is 5-[(5-nitrofuran-2-yl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one.
| Compound Name | 5-[(5-nitrofuran-2-yl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 1211318 |
| Molecular Formula | C20H13N3O4S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 5-[(5-nitrofuran-2-yl)methylidene]-3-phenyl-2-phenylimino-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2ccc([N+](=O)[O-])o2)S/C(=N\c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C20H13N3O4S/c24-19-17(13-16-11-12-18(27-16)23(25)26)28-20(21-14-7-3-1-4-8-14)22(19)15-9-5-2-6-10-15/h1-13H/b17-13?,21-20- |
| InChIKey | OTTNLVHZXSQNIQ-RNGNLNKYSA-N |
| XLogP | 5.00 |
| TPSA | 88.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_C(13)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|