C21H12BrF3N2O2 — CID 2292454
(4Z)-4-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-phenyl-5-(trifluoromethyl)pyrazol-3-one (PubChem CID 2292454) has the molecular formula C21H12BrF3N2O2 and a molecular weight of 461.24 g/mol. Its IUPAC name is (4Z)-4-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-phenyl-5-(trifluoromethyl)pyrazol-3-one.
| Compound Name | (4Z)-4-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-phenyl-5-(trifluoromethyl)pyrazol-3-one |
|---|---|
| PubChem CID | 2292454 |
| Molecular Formula | C21H12BrF3N2O2 |
| Molecular Weight | 461.24 g/mol |
| Exact Mass | 460.00 |
| IUPAC Name | (4Z)-4-[[5-(4-bromophenyl)furan-2-yl]methylidene]-2-phenyl-5-(trifluoromethyl)pyrazol-3-one |
| SMILES | O=C1/C(=C\c2ccc(-c3ccc(Br)cc3)o2)C(C(F)(F)F)=NN1c1ccccc1 |
| InChI | InChI=1S/C21H12BrF3N2O2/c22-14-8-6-13(7-9-14)18-11-10-16(29-18)12-17-19(21(23,24)25)26-27(20(17)28)15-4-2-1-3-5-15/h1-12H/b17-12- |
| InChIKey | MVENOAXXEGYAQB-ATVHPVEESA-N |
| XLogP | 6.06 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.24 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|