C24H19N5O6S3 — CID 50885302
4-[5-[(Z)-[3-methyl-5-oxo-1-(4-sulfamoylphenyl)pyrazol-4-ylidene]methyl]furan-2-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 50885302) has the molecular formula C24H19N5O6S3 and a molecular weight of 569.65 g/mol. Its IUPAC name is 4-[5-[(Z)-[3-methyl-5-oxo-1-(4-sulfamoylphenyl)pyrazol-4-ylidene]methyl]furan-2-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[5-[(Z)-[3-methyl-5-oxo-1-(4-sulfamoylphenyl)pyrazol-4-ylidene]methyl]furan-2-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 50885302 |
| Molecular Formula | C24H19N5O6S3 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 569.05 |
| IUPAC Name | 4-[5-[(Z)-[3-methyl-5-oxo-1-(4-sulfamoylphenyl)pyrazol-4-ylidene]methyl]furan-2-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CC1=NN(c2ccc(S(N)(=O)=O)cc2)C(=O)/C1=C\c1ccc(-c2ccc(S(=O)(=O)Nc3nccs3)cc2)o1 |
| InChI | InChI=1S/C24H19N5O6S3/c1-15-21(23(30)29(27-15)17-4-9-19(10-5-17)37(25,31)32)14-18-6-11-22(35-18)16-2-7-20(8-3-16)38(33,34)28-24-26-12-13-36-24/h2-14H,1H3,(H,26,28)(H2,25,31,32)/b21-14- |
| InChIKey | SMXDFDLBCPDIJX-STZFKDTASA-N |
| XLogP | 3.66 |
| TPSA | 165.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|