C17H12N4O4S2 — CID 4613880
2-cyano-3-[5-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]furan-2-yl]prop-2-enamide (PubChem CID 4613880) has the molecular formula C17H12N4O4S2 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-cyano-3-[5-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]furan-2-yl]prop-2-enamide.
| Compound Name | 2-cyano-3-[5-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4613880 |
| Molecular Formula | C17H12N4O4S2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-cyano-3-[5-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]furan-2-yl]prop-2-enamide |
| SMILES | N#CC(=Cc1ccc(-c2ccc(S(=O)(=O)Nc3nccs3)cc2)o1)C(N)=O |
| InChI | InChI=1S/C17H12N4O4S2/c18-10-12(16(19)22)9-13-3-6-15(25-13)11-1-4-14(5-2-11)27(23,24)21-17-20-7-8-26-17/h1-9H,(H2,19,22)(H,20,21) |
| InChIKey | LBDYYLPZJCFHEH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|