C24H17N5O7S2 — CID 17270038
(E)-2-cyano-3-[5-[(4-nitrophenoxy)methyl]furan-2-yl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 17270038) has the molecular formula C24H17N5O7S2 and a molecular weight of 551.56 g/mol. Its IUPAC name is (E)-2-cyano-3-[5-[(4-nitrophenoxy)methyl]furan-2-yl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-2-cyano-3-[5-[(4-nitrophenoxy)methyl]furan-2-yl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17270038 |
| Molecular Formula | C24H17N5O7S2 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.06 |
| IUPAC Name | (E)-2-cyano-3-[5-[(4-nitrophenoxy)methyl]furan-2-yl]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | N#C/C(=C\c1ccc(COc2ccc([N+](=O)[O-])cc2)o1)C(=O)Nc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C24H17N5O7S2/c25-14-16(13-20-7-8-21(36-20)15-35-19-5-3-18(4-6-19)29(31)32)23(30)27-17-1-9-22(10-2-17)38(33,34)28-24-26-11-12-37-24/h1-13H,15H2,(H,26,28)(H,27,30)/b16-13+ |
| InChIKey | UNDQMRKAULOOFI-DTQAZKPQSA-N |
| XLogP | 4.57 |
| TPSA | 177.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|